C17H19N7O — CID 95282434
[(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 95282434) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is [(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 95282434 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [(3R)-3-(4-methylpyrazol-1-yl)piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | Cc1cnn([C@@H]2CCCN(C(=O)c3cccc(-n4cnnn4)c3)C2)c1 |
| InChI | InChI=1S/C17H19N7O/c1-13-9-19-23(10-13)16-6-3-7-22(11-16)17(25)14-4-2-5-15(8-14)24-12-18-20-21-24/h2,4-5,8-10,12,16H,3,6-7,11H2,1H3/t16-/m1/s1 |
| InChIKey | VBSJZRCCWKJJOD-MRXNPFEDSA-N |
| XLogP | 1.64 |
| TPSA | 81.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |