C17H19N3O3 — CID 166193415
1-[1-(3-methylbenzoyl)piperidin-3-yl]pyrazole-4-carboxylic acid (PubChem CID 166193415) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-[1-(3-methylbenzoyl)piperidin-3-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-(3-methylbenzoyl)piperidin-3-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166193415 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-[1-(3-methylbenzoyl)piperidin-3-yl]pyrazole-4-carboxylic acid |
| SMILES | Cc1cccc(C(=O)N2CCCC(n3cc(C(=O)O)cn3)C2)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-12-4-2-5-13(8-12)16(21)19-7-3-6-15(11-19)20-10-14(9-18-20)17(22)23/h2,4-5,8-10,15H,3,6-7,11H2,1H3,(H,22,23) |
| InChIKey | UJYJQVYOOASLSL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |