C20H28N6O — CID 52523347
[(3S)-3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 52523347) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is [(3S)-3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [(3S)-3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 52523347 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [(3S)-3-[(4-methylpiperidin-1-yl)methyl]piperidin-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | CC1CCN(C[C@@H]2CCCN(C(=O)c3cccc(-n4cnnn4)c3)C2)CC1 |
| InChI | InChI=1S/C20H28N6O/c1-16-7-10-24(11-8-16)13-17-4-3-9-25(14-17)20(27)18-5-2-6-19(12-18)26-15-21-22-23-26/h2,5-6,12,15-17H,3-4,7-11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | JIMAOEPWFSHHMA-KRWDZBQOSA-N |
| XLogP | 2.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |