C16H22Cl2N4O — CID 119947144
(2-aminophenyl)-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119947144) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.29 g/mol. Its IUPAC name is (2-aminophenyl)-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119947144 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (2-aminophenyl)-[3-(4-methylpyrazol-1-yl)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | Cc1cnn(C2CCCN(C(=O)c3ccccc3N)C2)c1.Cl.Cl |
| InChI | InChI=1S/C16H20N4O.2ClH/c1-12-9-18-20(10-12)13-5-4-8-19(11-13)16(21)14-6-2-3-7-15(14)17;;/h2-3,6-7,9-10,13H,4-5,8,11,17H2,1H3;2*1H |
| InChIKey | KXIFWTZOGDEUNZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|