C20H19F2N3O — CID 26315953
[(3S)-3-(4-fluoroanilino)piperidin-1-yl]-(5-fluoro-1H-indol-2-yl)methanone (PubChem CID 26315953) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is [(3S)-3-(4-fluoroanilino)piperidin-1-yl]-(5-fluoro-1H-indol-2-yl)methanone.
| Compound Name | [(3S)-3-(4-fluoroanilino)piperidin-1-yl]-(5-fluoro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 26315953 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | [(3S)-3-(4-fluoroanilino)piperidin-1-yl]-(5-fluoro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2cc(F)ccc2[nH]1)N1CCC[C@H](Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H19F2N3O/c21-14-3-6-16(7-4-14)23-17-2-1-9-25(12-17)20(26)19-11-13-10-15(22)5-8-18(13)24-19/h3-8,10-11,17,23-24H,1-2,9,12H2/t17-/m0/s1 |
| InChIKey | ACLONTYXGCYVFP-KRWDZBQOSA-N |
| XLogP | 4.16 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |