C14H18F2N4O — CID 91783251
(3,5-difluoro-2-pyridinyl)-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methanone (PubChem CID 91783251) has the molecular formula C14H18F2N4O and a molecular weight of 296.32 g/mol. Its IUPAC name is (3,5-difluoro-2-pyridinyl)-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (3,5-difluoro-2-pyridinyl)-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 91783251 |
| Molecular Formula | C14H18F2N4O |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3,5-difluoro-2-pyridinyl)-(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CN1CCN2CCN(C(=O)c3ncc(F)cc3F)CC2C1 |
| InChI | InChI=1S/C14H18F2N4O/c1-18-2-3-19-4-5-20(9-11(19)8-18)14(21)13-12(16)6-10(15)7-17-13/h6-7,11H,2-5,8-9H2,1H3 |
| InChIKey | BVPNCDTVVMTABA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |