C14H19N5O — CID 77087187
(5-methyl-1H-imidazol-2-yl)-[4-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone (PubChem CID 77087187) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is (5-methyl-1H-imidazol-2-yl)-[4-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | (5-methyl-1H-imidazol-2-yl)-[4-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 77087187 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (5-methyl-1H-imidazol-2-yl)-[4-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methanone |
| SMILES | Cc1cnc(C(=O)N2CCC(c3[nH]ncc3C)CC2)[nH]1 |
| InChI | InChI=1S/C14H19N5O/c1-9-7-16-18-12(9)11-3-5-19(6-4-11)14(20)13-15-8-10(2)17-13/h7-8,11H,3-6H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | YAGXGBJUJVHHFA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |