C15H26N2 — CID 173176811
5-cycloundecyl-4-methyl-1H-pyrazole (PubChem CID 173176811) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 5-cycloundecyl-4-methyl-1H-pyrazole.
| Compound Name | 5-cycloundecyl-4-methyl-1H-pyrazole |
|---|---|
| PubChem CID | 173176811 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 5-cycloundecyl-4-methyl-1H-pyrazole |
| SMILES | Cc1cn[nH]c1C1CCCCCCCCCC1 |
| InChI | InChI=1S/C15H26N2/c1-13-12-16-17-15(13)14-10-8-6-4-2-3-5-7-9-11-14/h12,14H,2-11H2,1H3,(H,16,17) |
| InChIKey | KJYSVGQOBCFENX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |