C23H27N3 — CID 42479587
(3R)-1-(2,2-diphenylethyl)-3-(4-methyl-1H-pyrazol-5-yl)piperidine (PubChem CID 42479587) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is (3R)-1-(2,2-diphenylethyl)-3-(4-methyl-1H-pyrazol-5-yl)piperidine.
| Compound Name | (3R)-1-(2,2-diphenylethyl)-3-(4-methyl-1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 42479587 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | (3R)-1-(2,2-diphenylethyl)-3-(4-methyl-1H-pyrazol-5-yl)piperidine |
| SMILES | Cc1cn[nH]c1[C@@H]1CCCN(CC(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C23H27N3/c1-18-15-24-25-23(18)21-13-8-14-26(16-21)17-22(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,15,21-22H,8,13-14,16-17H2,1H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | YGXZXCJXRORJAI-OAQYLSRUSA-N |
| XLogP | 4.73 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |