C17H21N3O2 — CID 125010591
2-[[(3R)-3-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 125010591) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[[(3R)-3-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 2-[[(3R)-3-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 125010591 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[[(3R)-3-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | Cc1cn[nH]c1[C@@H]1CCCN(Cc2ccccc2C(=O)O)C1 |
| InChI | InChI=1S/C17H21N3O2/c1-12-9-18-19-16(12)14-6-4-8-20(11-14)10-13-5-2-3-7-15(13)17(21)22/h2-3,5,7,9,14H,4,6,8,10-11H2,1H3,(H,18,19)(H,21,22)/t14-/m1/s1 |
| InChIKey | VKLJDZVOWKSETB-CQSZACIVSA-N |
| XLogP | 2.80 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |