C16H16F3N3 — CID 124971747
2-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]pyrazine (PubChem CID 124971747) has the molecular formula C16H16F3N3 and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]pyrazine.
| Compound Name | 2-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 124971747 |
| Molecular Formula | C16H16F3N3 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[(2S)-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-yl]pyrazine |
| SMILES | FC(F)(F)c1ccc(CN2CCC[C@H]2c2cnccn2)cc1 |
| InChI | InChI=1S/C16H16F3N3/c17-16(18,19)13-5-3-12(4-6-13)11-22-9-1-2-15(22)14-10-20-7-8-21-14/h3-8,10,15H,1-2,9,11H2/t15-/m0/s1 |
| InChIKey | JYOAZPMFYGREIF-HNNXBMFYSA-N |
| XLogP | 3.83 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |