C15H15F2N3 — CID 110103097
2-[1-[(3,5-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine (PubChem CID 110103097) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[1-[(3,5-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine.
| Compound Name | 2-[1-[(3,5-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 110103097 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[1-[(3,5-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine |
| SMILES | Fc1cc(F)cc(CN2CCCC2c2cnccn2)c1 |
| InChI | InChI=1S/C15H15F2N3/c16-12-6-11(7-13(17)8-12)10-20-5-1-2-15(20)14-9-18-3-4-19-14/h3-4,6-9,15H,1-2,5,10H2 |
| InChIKey | PFQMGDWMBVADFA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |