C15H15F2N3 — CID 124941847
2-[(2R)-1-[(2,4-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine (PubChem CID 124941847) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[(2R)-1-[(2,4-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine.
| Compound Name | 2-[(2R)-1-[(2,4-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 124941847 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[(2R)-1-[(2,4-difluorophenyl)methyl]pyrrolidin-2-yl]pyrazine |
| SMILES | Fc1ccc(CN2CCC[C@@H]2c2cnccn2)c(F)c1 |
| InChI | InChI=1S/C15H15F2N3/c16-12-4-3-11(13(17)8-12)10-20-7-1-2-15(20)14-9-18-5-6-19-14/h3-6,8-9,15H,1-2,7,10H2/t15-/m1/s1 |
| InChIKey | AQJDQBYJYBNUJJ-OAHLLOKOSA-N |
| XLogP | 3.09 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |