C16H17F2N3 — CID 124953340
4-[(2S)-1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]pyrimidine (PubChem CID 124953340) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[(2S)-1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]pyrimidine.
| Compound Name | 4-[(2S)-1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]pyrimidine |
|---|---|
| PubChem CID | 124953340 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-[(2S)-1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]pyrimidine |
| SMILES | Fc1ccc(F)c(CN2CCCC[C@H]2c2ccncn2)c1 |
| InChI | InChI=1S/C16H17F2N3/c17-13-4-5-14(18)12(9-13)10-21-8-2-1-3-16(21)15-6-7-19-11-20-15/h4-7,9,11,16H,1-3,8,10H2/t16-/m0/s1 |
| InChIKey | DURZIYNJXBXJHI-INIZCTEOSA-N |
| XLogP | 3.48 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |