C21H26FNO2 — CID 92878124
(2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-(3-fluorophenyl)azepane (PubChem CID 92878124) has the molecular formula C21H26FNO2 and a molecular weight of 343.44 g/mol. Its IUPAC name is (2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-(3-fluorophenyl)azepane.
| Compound Name | (2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-(3-fluorophenyl)azepane |
|---|---|
| PubChem CID | 92878124 |
| Molecular Formula | C21H26FNO2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (2R)-1-[(2,4-dimethoxyphenyl)methyl]-2-(3-fluorophenyl)azepane |
| SMILES | COc1ccc(CN2CCCCC[C@@H]2c2cccc(F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H26FNO2/c1-24-19-11-10-17(21(14-19)25-2)15-23-12-5-3-4-9-20(23)16-7-6-8-18(22)13-16/h6-8,10-11,13-14,20H,3-5,9,12,15H2,1-2H3/t20-/m1/s1 |
| InChIKey | CSCQVXKAXQTZLX-HXUWFJFHSA-N |
| XLogP | 4.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |