C21H27NO3 — CID 92878226
2-methoxy-6-[[(2S)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenol (PubChem CID 92878226) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-methoxy-6-[[(2S)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-6-[[(2S)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 92878226 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-methoxy-6-[[(2S)-2-(4-methoxyphenyl)azepan-1-yl]methyl]phenol |
| SMILES | COc1ccc([C@@H]2CCCCCN2Cc2cccc(OC)c2O)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-24-18-12-10-16(11-13-18)19-8-4-3-5-14-22(19)15-17-7-6-9-20(25-2)21(17)23/h6-7,9-13,19,23H,3-5,8,14-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | OIOKZZVVQKBMBO-IBGZPJMESA-N |
| XLogP | 4.53 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|