C13H19NO2S — CID 84593778
2-(1,3-dioxolan-2-yl)-1-(thiophen-2-ylmethyl)piperidine (PubChem CID 84593778) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-1-(thiophen-2-ylmethyl)piperidine.
| Compound Name | 2-(1,3-dioxolan-2-yl)-1-(thiophen-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 84593778 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-1-(thiophen-2-ylmethyl)piperidine |
| SMILES | c1csc(CN2CCCCC2C2OCCO2)c1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-6-14(10-11-4-3-9-17-11)12(5-1)13-15-7-8-16-13/h3-4,9,12-13H,1-2,5-8,10H2 |
| InChIKey | AYMQAYUCEMYZLW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |