C18H28N2S — CID 124749486
(1R,8aS)-1-cyclohexyl-2-(thiophen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 124749486) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is (1R,8aS)-1-cyclohexyl-2-(thiophen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1R,8aS)-1-cyclohexyl-2-(thiophen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 124749486 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1R,8aS)-1-cyclohexyl-2-(thiophen-2-ylmethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | c1csc(CN2CCN3CCC[C@H]3[C@H]2C2CCCCC2)c1 |
| InChI | InChI=1S/C18H28N2S/c1-2-6-15(7-3-1)18-17-9-4-10-19(17)11-12-20(18)14-16-8-5-13-21-16/h5,8,13,15,17-18H,1-4,6-7,9-12,14H2/t17-,18+/m0/s1 |
| InChIKey | AQLRASXAHOOIBE-ZWKOTPCHSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |