C24H31N3O3 — CID 11905939
(1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 11905939) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 11905939 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(CN3CCN4CCC[C@@H]4[C@@H]3C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c28-27(29)20-10-8-18(9-11-20)23-13-12-21(30-23)17-26-16-15-25-14-4-7-22(25)24(26)19-5-2-1-3-6-19/h8-13,19,22,24H,1-7,14-17H2/t22-,24+/m1/s1 |
| InChIKey | AISJZLDKTZIPOX-VWNXMTODSA-N |
| XLogP | 5.08 |
| TPSA | 62.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|