C24H33N3O3+2 — CID 11905938
(1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium (PubChem CID 11905938) has the molecular formula C24H33N3O3+2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium.
| Compound Name | (1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium |
|---|---|
| PubChem CID | 11905938 |
| Molecular Formula | C24H33N3O3+2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (1S,8aR)-1-cyclohexyl-2-[[5-(4-nitrophenyl)furan-2-yl]methyl]-2,3,4,5,6,7,8,8a-octahydro-1H-pyrrolo[1,2-a]pyrazine-2,5-diium |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C[NH+]3CC[NH+]4CCC[C@@H]4[C@@H]3C3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c28-27(29)20-10-8-18(9-11-20)23-13-12-21(30-23)17-26-16-15-25-14-4-7-22(25)24(26)19-5-2-1-3-6-19/h8-13,19,22,24H,1-7,14-17H2/p+2/t22-,24+/m1/s1 |
| InChIKey | AISJZLDKTZIPOX-VWNXMTODSA-P |
| XLogP | 2.25 |
| TPSA | 65.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|