About [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate
[(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 7355829) has the molecular formula C17H15NO6
and a molecular weight of 329.31 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate.
Molecular Properties
| Compound Name | [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| PubChem CID | 7355829 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | O=C(O[C@@H]1CCCCC1=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C17H15NO6/c19-13-3-1-2-4-15(13)24-17(20)16-10-9-14(23-16)11-5-7-12(8-6-11)18(21)22/h5-10,15H,1-4H2/t15-/m1/s1 |
| InChIKey | LDBPZFDHFJOVGI-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate?
The IUPAC name of [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate (CID 7355829) is [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate.
What is the SMILES notation for [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate?
The canonical SMILES for [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate is O=C(O[C@@H]1CCCCC1=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1.
What is the InChIKey of [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate?
The InChIKey is LDBPZFDHFJOVGI-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H15NO6/c19-13-3-1-2-4-15(13)24-17(20)16-10-9-14(23-16)11-5-7-12(8-6-11)18(21)22/h5-10,15H,1-4H2/t15-/m1/s1.
What are the key properties of [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate?
[(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate has a molecular weight of 329.31 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-oxocyclohexyl] 5-(4-nitrophenyl)furan-2-carboxylate is sourced from PubChem (CID 7355829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).