C23H38N2 — CID 11905943
(1S,8aR)-1-cyclohexyl-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 11905943) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is (1S,8aR)-1-cyclohexyl-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (1S,8aR)-1-cyclohexyl-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 11905943 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | (1S,8aR)-1-cyclohexyl-2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCN4CCC[C@@H]4[C@@H]3C3CCCCC3)[C@@H]1C2 |
| InChI | InChI=1S/C23H38N2/c1-23(2)19-11-10-18(20(23)15-19)16-25-14-13-24-12-6-9-21(24)22(25)17-7-4-3-5-8-17/h10,17,19-22H,3-9,11-16H2,1-2H3/t19-,20-,21+,22-/m0/s1 |
| InChIKey | MDUNPKZOBHMOBW-KJJMTIBFSA-N |
| XLogP | 4.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|