C26H36N2O — CID 42470943
1-[(4aR,8aS)-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone (PubChem CID 42470943) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-[(4aR,8aS)-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone.
| Compound Name | 1-[(4aR,8aS)-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 42470943 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 1-[(4aR,8aS)-1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCC[C@@H]4CN(C(=O)Cc5ccccc5)CC[C@@H]43)[C@@H]1C2 |
| InChI | InChI=1S/C26H36N2O/c1-26(2)22-11-10-20(23(26)16-22)17-27-13-6-9-21-18-28(14-12-24(21)27)25(29)15-19-7-4-3-5-8-19/h3-5,7-8,10,21-24H,6,9,11-18H2,1-2H3/t21-,22+,23+,24+/m1/s1 |
| InChIKey | MISNNUFHYXNKTC-SBFWRKJZSA-N |
| XLogP | 4.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|