C24H27ClN2O3 — CID 42327079
1-[(4aR,8aS)-1-[2-(2-chlorophenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone (PubChem CID 42327079) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is 1-[(4aR,8aS)-1-[2-(2-chlorophenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone.
| Compound Name | 1-[(4aR,8aS)-1-[2-(2-chlorophenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 42327079 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-[(4aR,8aS)-1-[2-(2-chlorophenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CC[C@H]2[C@H](CCCN2C(=O)COc2ccccc2Cl)C1 |
| InChI | InChI=1S/C24H27ClN2O3/c25-20-10-4-5-11-22(20)30-17-24(29)27-13-6-9-19-16-26(14-12-21(19)27)23(28)15-18-7-2-1-3-8-18/h1-5,7-8,10-11,19,21H,6,9,12-17H2/t19-,21+/m1/s1 |
| InChIKey | NRNROOMVGDUHGD-CTNGQTDRSA-N |
| XLogP | 3.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |