C20H28N2O2 — CID 56856589
1-[(4aR,8aS)-6-acetyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-phenylbutan-1-one (PubChem CID 56856589) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-acetyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[(4aR,8aS)-6-acetyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 56856589 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[(4aR,8aS)-6-acetyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-phenylbutan-1-one |
| SMILES | CC(=O)N1CC[C@H]2[C@H](CCCN2C(=O)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C20H28N2O2/c1-16(23)21-14-12-19-18(15-21)10-6-13-22(19)20(24)11-5-9-17-7-3-2-4-8-17/h2-4,7-8,18-19H,5-6,9-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | HFBPNUOGEZJECY-MOPGFXCFSA-N |
| XLogP | 2.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |