C24H29FN2O2S — CID 56855519
1-[(4aR,8aS)-6-[2-(2-fluorophenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 56855519) has the molecular formula C24H29FN2O2S and a molecular weight of 428.57 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-[2-(2-fluorophenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[(4aR,8aS)-6-[2-(2-fluorophenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 56855519 |
| Molecular Formula | C24H29FN2O2S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-[(4aR,8aS)-6-[2-(2-fluorophenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(Cc1ccccc1F)N1CC[C@H]2[C@H](CCCN2C(=O)CCCc2cccs2)C1 |
| InChI | InChI=1S/C24H29FN2O2S/c25-21-10-2-1-6-18(21)16-24(29)26-14-12-22-19(17-26)7-4-13-27(22)23(28)11-3-8-20-9-5-15-30-20/h1-2,5-6,9-10,15,19,22H,3-4,7-8,11-14,16-17H2/t19-,22+/m1/s1 |
| InChIKey | KRMNWTIRYSOVMK-KNQAVFIVSA-N |
| XLogP | 4.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |