C26H32N2O4 — CID 42371887
1-[(4aR,8aS)-1-[2-(4-methylphenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-methoxyphenyl)ethanone (PubChem CID 42371887) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 1-[(4aR,8aS)-1-[2-(4-methylphenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-methoxyphenyl)ethanone.
| Compound Name | 1-[(4aR,8aS)-1-[2-(4-methylphenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 42371887 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 1-[(4aR,8aS)-1-[2-(4-methylphenoxy)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CC[C@H]3[C@H](CCCN3C(=O)COc3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C26H32N2O4/c1-19-5-9-23(10-6-19)32-18-26(30)28-14-3-4-21-17-27(15-13-24(21)28)25(29)16-20-7-11-22(31-2)12-8-20/h5-12,21,24H,3-4,13-18H2,1-2H3/t21-,24+/m1/s1 |
| InChIKey | TWPNMRSEQYFGST-QPPBQGQZSA-N |
| XLogP | 3.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |