C24H28N2O3S — CID 42539902
(E)-1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 42539902) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is (E)-1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 42539902 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (E)-1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | COc1ccc(CC(=O)N2CC[C@H]3[C@H](CCCN3C(=O)/C=C/c3cccs3)C2)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-29-20-8-6-18(7-9-20)16-24(28)25-14-12-22-19(17-25)4-2-13-26(22)23(27)11-10-21-5-3-15-30-21/h3,5-11,15,19,22H,2,4,12-14,16-17H2,1H3/b11-10+/t19-,22+/m1/s1 |
| InChIKey | UCMCJOZQLOGFPX-MIYJXHNBSA-N |
| XLogP | 3.85 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|