C23H28N2O3S — CID 126467390
1-[(4aR,8aR)-1-(3-methylthiophene-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-methoxyphenyl)ethanone (PubChem CID 126467390) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[(4aR,8aR)-1-(3-methylthiophene-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-[(4aR,8aR)-1-(3-methylthiophene-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 126467390 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 1-[(4aR,8aR)-1-(3-methylthiophene-2-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)N2CC[C@@H]3[C@H](CCCN3C(=O)c3sccc3C)C2)c1 |
| InChI | InChI=1S/C23H28N2O3S/c1-16-9-12-29-22(16)23(27)25-10-4-6-18-15-24(11-8-20(18)25)21(26)14-17-5-3-7-19(13-17)28-2/h3,5,7,9,12-13,18,20H,4,6,8,10-11,14-15H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | PFUXWBJQBCBSPV-UYAOXDASSA-N |
| XLogP | 3.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |