C26H29ClN2O3 — CID 91940335
1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one (PubChem CID 91940335) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is 1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one.
| Compound Name | 1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91940335 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-[(4aR,8aS)-6-[2-(4-methoxyphenyl)acetyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-(2-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(CC(=O)N2CC[C@H]3[C@H](CCCN3C(=O)C=Cc3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C26H29ClN2O3/c1-32-22-11-8-19(9-12-22)17-26(31)28-16-14-24-21(18-28)6-4-15-29(24)25(30)13-10-20-5-2-3-7-23(20)27/h2-3,5,7-13,21,24H,4,6,14-18H2,1H3/t21-,24+/m1/s1 |
| InChIKey | JBQLAXRMQBYUBG-QPPBQGQZSA-N |
| XLogP | 4.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|