C25H32N2O2 — CID 95795639
1-[(5aS,8aS)-1-[2-(4-methoxyphenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-phenylethanone (PubChem CID 95795639) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-[(5aS,8aS)-1-[2-(4-methoxyphenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-phenylethanone.
| Compound Name | 1-[(5aS,8aS)-1-[2-(4-methoxyphenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 95795639 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[(5aS,8aS)-1-[2-(4-methoxyphenyl)ethyl]-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-phenylethanone |
| SMILES | COc1ccc(CCN2CCCC[C@H]3CN(C(=O)Cc4ccccc4)C[C@H]32)cc1 |
| InChI | InChI=1S/C25H32N2O2/c1-29-23-12-10-20(11-13-23)14-16-26-15-6-5-9-22-18-27(19-24(22)26)25(28)17-21-7-3-2-4-8-21/h2-4,7-8,10-13,22,24H,5-6,9,14-19H2,1H3/t22-,24+/m0/s1 |
| InChIKey | WHRKBPNTEMOLCX-LADGPHEKSA-N |
| XLogP | 3.79 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |