C24H31N3O3 — CID 92597882
1-[(5aS,8aS)-1-(pyridin-3-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-(3,4-dimethoxyphenyl)ethanone (PubChem CID 92597882) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[(5aS,8aS)-1-(pyridin-3-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-(3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-[(5aS,8aS)-1-(pyridin-3-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-(3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 92597882 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[(5aS,8aS)-1-(pyridin-3-ylmethyl)-2,3,4,5,5a,6,8,8a-octahydropyrrolo[3,4-b]azepin-7-yl]-2-(3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(CC(=O)N2C[C@@H]3CCCCN(Cc4cccnc4)[C@@H]3C2)cc1OC |
| InChI | InChI=1S/C24H31N3O3/c1-29-22-9-8-18(12-23(22)30-2)13-24(28)27-16-20-7-3-4-11-26(21(20)17-27)15-19-6-5-10-25-14-19/h5-6,8-10,12,14,20-21H,3-4,7,11,13,15-17H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | PYKTVKKFQOFWAH-LEWJYISDSA-N |
| XLogP | 3.15 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |