C20H25NOS — CID 70779192
(4S,4aS,8aS)-4-phenyl-1-(thiophen-2-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol (PubChem CID 70779192) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is (4S,4aS,8aS)-4-phenyl-1-(thiophen-2-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol.
| Compound Name | (4S,4aS,8aS)-4-phenyl-1-(thiophen-2-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
|---|---|
| PubChem CID | 70779192 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (4S,4aS,8aS)-4-phenyl-1-(thiophen-2-ylmethyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
| SMILES | O[C@@]1(c2ccccc2)CCN(Cc2cccs2)[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H25NOS/c22-20(16-7-2-1-3-8-16)12-13-21(15-17-9-6-14-23-17)19-11-5-4-10-18(19)20/h1-3,6-9,14,18-19,22H,4-5,10-13,15H2/t18-,19-,20+/m0/s1 |
| InChIKey | XCVJEQVPBWQJQD-SLFFLAALSA-N |
| XLogP | 4.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |