C19H25N3OS — CID 133120621
(4R,4aR,8aR)-1-[(4-methylthiadiazol-5-yl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol (PubChem CID 133120621) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is (4R,4aR,8aR)-1-[(4-methylthiadiazol-5-yl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol.
| Compound Name | (4R,4aR,8aR)-1-[(4-methylthiadiazol-5-yl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
|---|---|
| PubChem CID | 133120621 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (4R,4aR,8aR)-1-[(4-methylthiadiazol-5-yl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
| SMILES | Cc1nnsc1CN1CC[C@](O)(c2ccccc2)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H25N3OS/c1-14-18(24-21-20-14)13-22-12-11-19(23,15-7-3-2-4-8-15)16-9-5-6-10-17(16)22/h2-4,7-8,16-17,23H,5-6,9-13H2,1H3/t16-,17-,19+/m1/s1 |
| InChIKey | SNRLLWRUZHIHJR-LMMKCTJWSA-N |
| XLogP | 3.50 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |