C22H32N2O2 — CID 133138770
3-[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 133138770) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 3-[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 133138770 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 3-[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CC[C@](O)(c2ccccc2)[C@@H]2CCCC[C@H]21)N1CCCC1 |
| InChI | InChI=1S/C22H32N2O2/c25-21(24-14-6-7-15-24)12-16-23-17-13-22(26,18-8-2-1-3-9-18)19-10-4-5-11-20(19)23/h1-3,8-9,19-20,26H,4-7,10-17H2/t19-,20-,22+/m1/s1 |
| InChIKey | XBRCPEMMXKUNMP-SJBKTWHCSA-N |
| XLogP | 3.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |