C22H24ClNO2 — CID 140548956
[(4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chlorophenyl)methanone (PubChem CID 140548956) has the molecular formula C22H24ClNO2 and a molecular weight of 369.89 g/mol. Its IUPAC name is [(4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chlorophenyl)methanone.
| Compound Name | [(4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 140548956 |
| Molecular Formula | C22H24ClNO2 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [(4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chlorophenyl)methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC(O)(c2ccccc2)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C22H24ClNO2/c23-19-12-6-4-10-17(19)21(25)24-15-14-22(26,16-8-2-1-3-9-16)18-11-5-7-13-20(18)24/h1-4,6,8-10,12,18,20,26H,5,7,11,13-15H2/t18-,20-,22?/m1/s1 |
| InChIKey | OJVXCVSNEWACOC-CJHNXZANSA-N |
| XLogP | 4.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |