C28H29NO2 — CID 140549023
[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-phenylphenyl)methanone (PubChem CID 140549023) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-phenylphenyl)methanone.
| Compound Name | [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-phenylphenyl)methanone |
|---|---|
| PubChem CID | 140549023 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(3-phenylphenyl)methanone |
| SMILES | O=C(c1cccc(-c2ccccc2)c1)N1CCC(O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C28H29NO2/c30-27(23-13-9-12-22(20-23)21-10-3-1-4-11-21)29-19-18-28(31,24-14-5-2-6-15-24)25-16-7-8-17-26(25)29/h1-6,9-15,20,25-26,31H,7-8,16-19H2/t25-,26+,28?/m1/s1 |
| InChIKey | ODXSLAYZKFISDQ-OQKNHUCHSA-N |
| XLogP | 5.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |