C29H29NO3 — CID 59285619
[2-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]phenyl]-phenylmethanone (PubChem CID 59285619) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is [2-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]phenyl]-phenylmethanone.
| Compound Name | [2-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 59285619 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | [2-[(4S,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccccc1C(=O)N1CC[C@@](O)(c2ccccc2)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C29H29NO3/c31-27(21-11-3-1-4-12-21)23-15-7-8-16-24(23)28(32)30-20-19-29(33,22-13-5-2-6-14-22)25-17-9-10-18-26(25)30/h1-8,11-16,25-26,33H,9-10,17-20H2/t25-,26-,29-/m1/s1 |
| InChIKey | ZXQATYNAIZNXDA-WWPJHQMMSA-N |
| XLogP | 5.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |