C21H24N2O3 — CID 133125106
[(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(5-hydroxy-2-pyridinyl)methanone (PubChem CID 133125106) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(5-hydroxy-2-pyridinyl)methanone.
| Compound Name | [(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(5-hydroxy-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 133125106 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [(4R,4aR,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(5-hydroxy-2-pyridinyl)methanone |
| SMILES | O=C(c1ccc(O)cn1)N1CC[C@](O)(c2ccccc2)[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H24N2O3/c24-16-10-11-18(22-14-16)20(25)23-13-12-21(26,15-6-2-1-3-7-15)17-8-4-5-9-19(17)23/h1-3,6-7,10-11,14,17,19,24,26H,4-5,8-9,12-13H2/t17-,19-,21+/m1/s1 |
| InChIKey | VQCSSUNTTGRDMI-QFUCXCTJSA-N |
| XLogP | 3.08 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |