C25H26N2O2S — CID 59285544
[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 59285544) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 59285544 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2ccccc2)n1)N1CC[C@](O)(c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C25H26N2O2S/c28-24(21-17-30-23(26-21)18-9-3-1-4-10-18)27-16-15-25(29,19-11-5-2-6-12-19)20-13-7-8-14-22(20)27/h1-6,9-12,17,20,22,29H,7-8,13-16H2/t20-,22+,25-/m0/s1 |
| InChIKey | LPXSPUQRXWLVAX-HOKHCIIBSA-N |
| XLogP | 5.10 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |