C22H26N2O3 — CID 140548968
4-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-6-methyl-1H-pyridin-2-one (PubChem CID 140548968) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-6-methyl-1H-pyridin-2-one.
| Compound Name | 4-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 140548968 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carbonyl]-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C(=O)N2CCC(O)(c3ccccc3)[C@@H]3CCCC[C@@H]32)cc(=O)[nH]1 |
| InChI | InChI=1S/C22H26N2O3/c1-15-13-16(14-20(25)23-15)21(26)24-12-11-22(27,17-7-3-2-4-8-17)18-9-5-6-10-19(18)24/h2-4,7-8,13-14,18-19,27H,5-6,9-12H2,1H3,(H,23,25)/t18-,19+,22?/m1/s1 |
| InChIKey | QHIWKBOVDCKMGX-DKPCLATOSA-N |
| XLogP | 2.98 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |