C22H25ClN2O3 — CID 59285564
[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chloro-6-methoxy-4-pyridinyl)methanone (PubChem CID 59285564) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chloro-6-methoxy-4-pyridinyl)methanone.
| Compound Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chloro-6-methoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 59285564 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-(2-chloro-6-methoxy-4-pyridinyl)methanone |
| SMILES | COc1cc(C(=O)N2CC[C@](O)(c3ccccc3)[C@H]3CCCC[C@H]32)cc(Cl)n1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-28-20-14-15(13-19(23)24-20)21(26)25-12-11-22(27,16-7-3-2-4-8-16)17-9-5-6-10-18(17)25/h2-4,7-8,13-14,17-18,27H,5-6,9-12H2,1H3/t17-,18+,22-/m0/s1 |
| InChIKey | SENLITHOEMYRFI-SVMVAKDDSA-N |
| XLogP | 4.04 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|