C26H27NO3 — CID 140548971
[(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(furan-2-yl)phenyl]methanone (PubChem CID 140548971) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(furan-2-yl)phenyl]methanone.
| Compound Name | [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(furan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 140548971 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [(4aR,8aS)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(furan-2-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-c2ccco2)c1)N1CCC(O)(c2ccccc2)[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C26H27NO3/c28-25(20-9-6-8-19(18-20)24-14-7-17-30-24)27-16-15-26(29,21-10-2-1-3-11-21)22-12-4-5-13-23(22)27/h1-3,6-11,14,17-18,22-23,29H,4-5,12-13,15-16H2/t22-,23+,26?/m1/s1 |
| InChIKey | ZEEUSJHECVRENQ-DBRKUKIDSA-N |
| XLogP | 5.24 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |