C22H27NO2 — CID 70759099
(4S,4aS,8aS)-1-[(3-hydroxyphenyl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol (PubChem CID 70759099) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (4S,4aS,8aS)-1-[(3-hydroxyphenyl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol.
| Compound Name | (4S,4aS,8aS)-1-[(3-hydroxyphenyl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
|---|---|
| PubChem CID | 70759099 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (4S,4aS,8aS)-1-[(3-hydroxyphenyl)methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
| SMILES | Oc1cccc(CN2CC[C@@](O)(c3ccccc3)[C@H]3CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C22H27NO2/c24-19-10-6-7-17(15-19)16-23-14-13-22(25,18-8-2-1-3-9-18)20-11-4-5-12-21(20)23/h1-3,6-10,15,20-21,24-25H,4-5,11-14,16H2/t20-,21-,22+/m0/s1 |
| InChIKey | YCQZRAWEEAQPMJ-FDFHNCONSA-N |
| XLogP | 4.04 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |