C23H25ClN4O2 — CID 124764224
(4R,4aR,8aS)-1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol (PubChem CID 124764224) has the molecular formula C23H25ClN4O2 and a molecular weight of 424.93 g/mol. Its IUPAC name is (4R,4aR,8aS)-1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol.
| Compound Name | (4R,4aR,8aS)-1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
|---|---|
| PubChem CID | 124764224 |
| Molecular Formula | C23H25ClN4O2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (4R,4aR,8aS)-1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-ol |
| SMILES | O[C@]1(c2ccccc2)CCN(Cc2nc(-c3cccnc3Cl)no2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H25ClN4O2/c24-21-17(9-6-13-25-21)22-26-20(30-27-22)15-28-14-12-23(29,16-7-2-1-3-8-16)18-10-4-5-11-19(18)28/h1-3,6-9,13,18-19,29H,4-5,10-12,14-15H2/t18-,19+,23+/m1/s1 |
| InChIKey | UPSVTWZBYSGRDW-MSYCTHLASA-N |
| XLogP | 4.44 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|