C20H21Cl2FN4O2 — CID 171669079
1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)azepan-4-ol;hydrochloride (PubChem CID 171669079) has the molecular formula C20H21Cl2FN4O2 and a molecular weight of 439.32 g/mol. Its IUPAC name is 1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)azepan-4-ol;hydrochloride.
| Compound Name | 1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)azepan-4-ol;hydrochloride |
|---|---|
| PubChem CID | 171669079 |
| Molecular Formula | C20H21Cl2FN4O2 |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1-[[3-(2-chloro-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-fluorophenyl)azepan-4-ol;hydrochloride |
| SMILES | Cl.OC1(c2ccc(F)cc2)CCCN(Cc2nc(-c3cccnc3Cl)no2)CC1 |
| InChI | InChI=1S/C20H20ClFN4O2.ClH/c21-18-16(3-1-10-23-18)19-24-17(28-25-19)13-26-11-2-8-20(27,9-12-26)14-4-6-15(22)7-5-14;/h1,3-7,10,27H,2,8-9,11-13H2;1H |
| InChIKey | NYROKIXYDBALKB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|