C14H17ClN4O — CID 51593014
3-(2-chloro-3-pyridinyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,2,4-oxadiazole (PubChem CID 51593014) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-(2-chloro-3-pyridinyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 51593014 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-5-[[(2S)-2-methylpiperidin-1-yl]methyl]-1,2,4-oxadiazole |
| SMILES | C[C@H]1CCCCN1Cc1nc(-c2cccnc2Cl)no1 |
| InChI | InChI=1S/C14H17ClN4O/c1-10-5-2-3-8-19(10)9-12-17-14(18-20-12)11-6-4-7-16-13(11)15/h4,6-7,10H,2-3,5,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | ZEMSKFSGTAUIPT-JTQLQIEISA-N |
| XLogP | 3.16 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|