C18H24FN3O — CID 110223517
1-[(2,3-dimethylimidazol-4-yl)methyl]-4-(4-fluorophenyl)azepan-4-ol (PubChem CID 110223517) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[(2,3-dimethylimidazol-4-yl)methyl]-4-(4-fluorophenyl)azepan-4-ol.
| Compound Name | 1-[(2,3-dimethylimidazol-4-yl)methyl]-4-(4-fluorophenyl)azepan-4-ol |
|---|---|
| PubChem CID | 110223517 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-[(2,3-dimethylimidazol-4-yl)methyl]-4-(4-fluorophenyl)azepan-4-ol |
| SMILES | Cc1ncc(CN2CCCC(O)(c3ccc(F)cc3)CC2)n1C |
| InChI | InChI=1S/C18H24FN3O/c1-14-20-12-17(21(14)2)13-22-10-3-8-18(23,9-11-22)15-4-6-16(19)7-5-15/h4-7,12,23H,3,8-11,13H2,1-2H3 |
| InChIKey | JLAAUQIYEDPBHZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |