C20H25ClFNO2 — CID 171667469
4-(4-fluorophenyl)-1-[(2-methoxy-5-methylphenyl)methyl]piperidin-4-ol;hydrochloride (PubChem CID 171667469) has the molecular formula C20H25ClFNO2 and a molecular weight of 365.88 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[(2-methoxy-5-methylphenyl)methyl]piperidin-4-ol;hydrochloride.
| Compound Name | 4-(4-fluorophenyl)-1-[(2-methoxy-5-methylphenyl)methyl]piperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 171667469 |
| Molecular Formula | C20H25ClFNO2 |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[(2-methoxy-5-methylphenyl)methyl]piperidin-4-ol;hydrochloride |
| SMILES | COc1ccc(C)cc1CN1CCC(O)(c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C20H24FNO2.ClH/c1-15-3-8-19(24-2)16(13-15)14-22-11-9-20(23,10-12-22)17-4-6-18(21)7-5-17;/h3-8,13,23H,9-12,14H2,1-2H3;1H |
| InChIKey | RKIFQVUYBJDTMD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |