C20H26ClNO2 — CID 42624389
4-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]piperidin-4-ol;hydrochloride (PubChem CID 42624389) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]piperidin-4-ol;hydrochloride.
| Compound Name | 4-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]piperidin-4-ol;hydrochloride |
|---|---|
| PubChem CID | 42624389 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-[(4-methylphenyl)methyl]piperidin-4-ol;hydrochloride |
| SMILES | COc1ccc(C2(O)CCN(Cc3ccc(C)cc3)CC2)cc1.Cl |
| InChI | InChI=1S/C20H25NO2.ClH/c1-16-3-5-17(6-4-16)15-21-13-11-20(22,12-14-21)18-7-9-19(23-2)10-8-18;/h3-10,22H,11-15H2,1-2H3;1H |
| InChIKey | RCZZIYCAPDWMSD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |